C19H24N2O10S — CID 18642547
(4-nitrophenyl)methyl (2S,4R)-4-methylsulfonyloxy-2-[(2-oxo-2-prop-2-enoxyethoxy)methyl]pyrrolidine-1-carboxylate (PubChem CID 18642547) has the molecular formula C19H24N2O10S and a molecular weight of 472.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-methylsulfonyloxy-2-[(2-oxo-2-prop-2-enoxyethoxy)methyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-methylsulfonyloxy-2-[(2-oxo-2-prop-2-enoxyethoxy)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18642547 |
| Molecular Formula | C19H24N2O10S |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-methylsulfonyloxy-2-[(2-oxo-2-prop-2-enoxyethoxy)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)COC[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H24N2O10S/c1-3-8-29-18(22)13-28-12-16-9-17(31-32(2,26)27)10-20(16)19(23)30-11-14-4-6-15(7-5-14)21(24)25/h3-7,16-17H,1,8-13H2,2H3/t16-,17+/m0/s1 |
| InChIKey | MBAFREPJUCGKGY-DLBZAZTESA-N |
| XLogP | 1.40 |
| TPSA | 151.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|