C19H25N3O8S — CID 57235017
(4-nitrophenyl)methyl (2S,4R)-2-[(1R,2R)-2-(dimethylcarbamoyl)cyclopropyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 57235017) has the molecular formula C19H25N3O8S and a molecular weight of 455.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[(1R,2R)-2-(dimethylcarbamoyl)cyclopropyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[(1R,2R)-2-(dimethylcarbamoyl)cyclopropyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57235017 |
| Molecular Formula | C19H25N3O8S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[(1R,2R)-2-(dimethylcarbamoyl)cyclopropyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=O)[C@@H]1C[C@H]1[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H25N3O8S/c1-20(2)18(23)16-9-15(16)17-8-14(30-31(3,27)28)10-21(17)19(24)29-11-12-4-6-13(7-5-12)22(25)26/h4-7,14-17H,8-11H2,1-3H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | MIIBTNSWQVTBPL-VQHPVUNQSA-N |
| XLogP | 1.37 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|