C17H20N2O11S — CID 25054909
2-O-ethoxycarbonyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 25054909) has the molecular formula C17H20N2O11S and a molecular weight of 460.42 g/mol. Its IUPAC name is 2-O-ethoxycarbonyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-ethoxycarbonyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25054909 |
| Molecular Formula | C17H20N2O11S |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-O-ethoxycarbonyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)OC(=O)[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N2O11S/c1-3-27-17(22)29-15(20)14-8-13(30-31(2,25)26)9-18(14)16(21)28-10-11-4-6-12(7-5-11)19(23)24/h4-7,13-14H,3,8-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | IJULAJDYLVWOON-KGLIPLIRSA-N |
| XLogP | 1.35 |
| TPSA | 168.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|