C16H21NO8S — CID 10572279
1-O-[(4-methoxyphenyl)methyl] 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 10572279) has the molecular formula C16H21NO8S and a molecular weight of 387.41 g/mol. Its IUPAC name is 1-O-[(4-methoxyphenyl)methyl] 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-[(4-methoxyphenyl)methyl] 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10572279 |
| Molecular Formula | C16H21NO8S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-O-[(4-methoxyphenyl)methyl] 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21NO8S/c1-22-12-6-4-11(5-7-12)10-24-16(19)17-9-13(25-26(3,20)21)8-14(17)15(18)23-2/h4-7,13-14H,8-10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | RMIYTVZTUUKWRJ-KGLIPLIRSA-N |
| XLogP | 0.92 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|