C14H27NO7S — CID 144771151
1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate;ethane (PubChem CID 144771151) has the molecular formula C14H27NO7S and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate;ethane.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate;ethane |
|---|---|
| PubChem CID | 144771151 |
| Molecular Formula | C14H27NO7S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate;ethane |
| SMILES | CC.COC(=O)[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO7S.C2H6/c1-12(2,3)19-11(15)13-7-8(20-21(5,16)17)6-9(13)10(14)18-4;1-2/h8-9H,6-7H2,1-5H3;1-2H3/t8-,9+;/m1./s1 |
| InChIKey | UARTWUZLUMZSID-RJUBDTSPSA-N |
| XLogP | 1.54 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|