C28H50N2O12S — CID 159843669
1-O-tert-butyl 2-O-methyl (2S,4R)-4-hexylsulfonyloxypyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 159843669) has the molecular formula C28H50N2O12S and a molecular weight of 638.78 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hexylsulfonyloxypyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hexylsulfonyloxypyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 159843669 |
| Molecular Formula | C28H50N2O12S |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hexylsulfonyloxypyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCCCS(=O)(=O)O[C@@H]1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1.COC(=O)[C@@H]1C[C@H](O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO7S.C11H19NO5/c1-6-7-8-9-10-26(21,22)25-13-11-14(15(19)23-5)18(12-13)16(20)24-17(2,3)4;1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h13-14H,6-12H2,1-5H3;7-8,13H,5-6H2,1-4H3/t13-,14+;7-,8-/m10/s1 |
| InChIKey | NOZZVDIKANXENJ-DOUJUDLESA-N |
| XLogP | 2.99 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|