C16H29NO5 — CID 170975970
1-O-tert-butyl 2-O-hexyl 4-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 170975970) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-hexyl 4-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-hexyl 4-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170975970 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-hexyl 4-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCCCOC(=O)C1CC(O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-5-6-7-8-9-21-14(19)13-10-12(18)11-17(13)15(20)22-16(2,3)4/h12-13,18H,5-11H2,1-4H3 |
| InChIKey | KPKDLCJCQKGKML-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|