C24H41NO5 — CID 162432833
2-O-tert-butyl 3-O-nonyl (3S,4aS,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate (PubChem CID 162432833) has the molecular formula C24H41NO5 and a molecular weight of 423.59 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-nonyl (3S,4aS,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-nonyl (3S,4aS,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 162432833 |
| Molecular Formula | C24H41NO5 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 2-O-tert-butyl 3-O-nonyl (3S,4aS,8aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)[C@@H]1C[C@H]2CC(=O)CC[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H41NO5/c1-5-6-7-8-9-10-11-14-29-22(27)21-16-19-15-20(26)13-12-18(19)17-25(21)23(28)30-24(2,3)4/h18-19,21H,5-17H2,1-4H3/t18-,19+,21-/m0/s1 |
| InChIKey | DXGYLBKEZMSYRV-ZVDOUQERSA-N |
| XLogP | 5.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|