C15H27NO4 — CID 67523029
2-O-butyl 1-O-tert-butyl (2R)-piperidine-1,2-dicarboxylate (PubChem CID 67523029) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-O-butyl 1-O-tert-butyl (2R)-piperidine-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-tert-butyl (2R)-piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67523029 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-O-butyl 1-O-tert-butyl (2R)-piperidine-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-5-6-11-19-13(17)12-9-7-8-10-16(12)14(18)20-15(2,3)4/h12H,5-11H2,1-4H3/t12-/m1/s1 |
| InChIKey | APECJBJZLSBMRZ-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|