C20H33NO4 — CID 91724315
2-O-decyl 1-O-prop-2-ynyl piperidine-1,2-dicarboxylate (PubChem CID 91724315) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-O-decyl 1-O-prop-2-ynyl piperidine-1,2-dicarboxylate.
| Compound Name | 2-O-decyl 1-O-prop-2-ynyl piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91724315 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-O-decyl 1-O-prop-2-ynyl piperidine-1,2-dicarboxylate |
| SMILES | C#CCOC(=O)N1CCCCC1C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C20H33NO4/c1-3-5-6-7-8-9-10-13-17-24-19(22)18-14-11-12-15-21(18)20(23)25-16-4-2/h2,18H,3,5-17H2,1H3 |
| InChIKey | LJUWCSVRFVGJFN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|