C12H13NO4 — CID 91721202
bis(prop-2-ynyl) pyrrolidine-1,2-dicarboxylate (PubChem CID 91721202) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is bis(prop-2-ynyl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | bis(prop-2-ynyl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91721202 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | bis(prop-2-ynyl) pyrrolidine-1,2-dicarboxylate |
| SMILES | C#CCOC(=O)C1CCCN1C(=O)OCC#C |
| InChI | InChI=1S/C12H13NO4/c1-3-8-16-11(14)10-6-5-7-13(10)12(15)17-9-4-2/h1-2,10H,5-9H2 |
| InChIKey | FSQYFQDNXPYJQH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|