C15H10F5NO4 — CID 102183482
2-O-(2,3,4,5,6-pentafluorophenyl) 1-O-prop-2-ynyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 102183482) has the molecular formula C15H10F5NO4 and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-O-(2,3,4,5,6-pentafluorophenyl) 1-O-prop-2-ynyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-(2,3,4,5,6-pentafluorophenyl) 1-O-prop-2-ynyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102183482 |
| Molecular Formula | C15H10F5NO4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-O-(2,3,4,5,6-pentafluorophenyl) 1-O-prop-2-ynyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | C#CCOC(=O)N1CCC[C@H]1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H10F5NO4/c1-2-6-24-15(23)21-5-3-4-7(21)14(22)25-13-11(19)9(17)8(16)10(18)12(13)20/h1,7H,3-6H2/t7-/m0/s1 |
| InChIKey | BLWUGWUMIFMQCT-ZETCQYMHSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|