C16H16F5NO3 — CID 14205741
butyl 1-(2,3,4,5,6-pentafluorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 14205741) has the molecular formula C16H16F5NO3 and a molecular weight of 365.30 g/mol. Its IUPAC name is butyl 1-(2,3,4,5,6-pentafluorobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | butyl 1-(2,3,4,5,6-pentafluorobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 14205741 |
| Molecular Formula | C16H16F5NO3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | butyl 1-(2,3,4,5,6-pentafluorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1CCCN1C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H16F5NO3/c1-2-3-7-25-16(24)8-5-4-6-22(8)15(23)9-10(17)12(19)14(21)13(20)11(9)18/h8H,2-7H2,1H3 |
| InChIKey | GAGCKAJPRAJFTL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|