C16H19ClFNO3 — CID 91736136
butyl 1-(3-chloro-2-fluorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 91736136) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is butyl 1-(3-chloro-2-fluorobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | butyl 1-(3-chloro-2-fluorobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91736136 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | butyl 1-(3-chloro-2-fluorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1CCCN1C(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C16H19ClFNO3/c1-2-3-10-22-16(21)13-8-5-9-19(13)15(20)11-6-4-7-12(17)14(11)18/h4,6-7,13H,2-3,5,8-10H2,1H3 |
| InChIKey | KGBFTDMYJDPOGR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|