C15H18FNO3 — CID 91711961
propyl 1-(2-fluorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 91711961) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is propyl 1-(2-fluorobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | propyl 1-(2-fluorobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91711961 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | propyl 1-(2-fluorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCOC(=O)C1CCCN1C(=O)c1ccccc1F |
| InChI | InChI=1S/C15H18FNO3/c1-2-10-20-15(19)13-8-5-9-17(13)14(18)11-6-3-4-7-12(11)16/h3-4,6-7,13H,2,5,8-10H2,1H3 |
| InChIKey | AUOQPPVLKKUODF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |