C19H25F2NO3 — CID 91722297
hexyl 1-(2,6-difluoro-3-methylbenzoyl)pyrrolidine-2-carboxylate (PubChem CID 91722297) has the molecular formula C19H25F2NO3 and a molecular weight of 353.41 g/mol. Its IUPAC name is hexyl 1-(2,6-difluoro-3-methylbenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | hexyl 1-(2,6-difluoro-3-methylbenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91722297 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | hexyl 1-(2,6-difluoro-3-methylbenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCCCOC(=O)C1CCCN1C(=O)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C19H25F2NO3/c1-3-4-5-6-12-25-19(24)15-8-7-11-22(15)18(23)16-14(20)10-9-13(2)17(16)21/h9-10,15H,3-8,11-12H2,1-2H3 |
| InChIKey | VLVZAYHNUWEMOH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|