C23H31F4NO3 — CID 91739319
decyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate (PubChem CID 91739319) has the molecular formula C23H31F4NO3 and a molecular weight of 445.50 g/mol. Its IUPAC name is decyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | decyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91739319 |
| Molecular Formula | C23H31F4NO3 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | decyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1CCCN1C(=O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C23H31F4NO3/c1-2-3-4-5-6-7-8-9-15-31-22(30)20-11-10-14-28(20)21(29)17-12-13-18(19(24)16-17)23(25,26)27/h12-13,16,20H,2-11,14-15H2,1H3 |
| InChIKey | OTOPFAJRPJOMQM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|