C20H17F4NO3 — CID 166200565
benzyl 1-[4-fluoro-3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate (PubChem CID 166200565) has the molecular formula C20H17F4NO3 and a molecular weight of 395.35 g/mol. Its IUPAC name is benzyl 1-[4-fluoro-3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-[4-fluoro-3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 166200565 |
| Molecular Formula | C20H17F4NO3 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | benzyl 1-[4-fluoro-3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CCCN1C(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F4NO3/c21-16-9-8-14(11-15(16)20(22,23)24)18(26)25-10-4-7-17(25)19(27)28-12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,17H,4,7,10,12H2 |
| InChIKey | WWAPSXLJWVNSDB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |