C21H20N2O3 — CID 95233575
benzyl (2R)-1-[3-(cyanomethyl)benzoyl]pyrrolidine-2-carboxylate (PubChem CID 95233575) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is benzyl (2R)-1-[3-(cyanomethyl)benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2R)-1-[3-(cyanomethyl)benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 95233575 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | benzyl (2R)-1-[3-(cyanomethyl)benzoyl]pyrrolidine-2-carboxylate |
| SMILES | N#CCc1cccc(C(=O)N2CCC[C@@H]2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H20N2O3/c22-12-11-16-8-4-9-18(14-16)20(24)23-13-5-10-19(23)21(25)26-15-17-6-2-1-3-7-17/h1-4,6-9,14,19H,5,10-11,13,15H2/t19-/m1/s1 |
| InChIKey | QIMARDPLEKRBJU-LJQANCHMSA-N |
| XLogP | 3.10 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |