C18H23N3O — CID 129427986
2-[3-[(2R)-2-[(2R)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile (PubChem CID 129427986) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[3-[(2R)-2-[(2R)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile.
| Compound Name | 2-[3-[(2R)-2-[(2R)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 129427986 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-[3-[(2R)-2-[(2R)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile |
| SMILES | CN1CCC[C@@H]1[C@H]1CCCN1C(=O)c1cccc(CC#N)c1 |
| InChI | InChI=1S/C18H23N3O/c1-20-11-3-7-16(20)17-8-4-12-21(17)18(22)15-6-2-5-14(13-15)9-10-19/h2,5-6,13,16-17H,3-4,7-9,11-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | LMMAZFUBHPTQTN-IAGOWNOFSA-N |
| XLogP | 2.45 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |