C17H21N3O — CID 95303105
3-[(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]benzonitrile (PubChem CID 95303105) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]benzonitrile.
| Compound Name | 3-[(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 95303105 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]benzonitrile |
| SMILES | CN1CCC[C@H]1[C@@H]1CCCN1C(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H21N3O/c1-19-9-3-7-15(19)16-8-4-10-20(16)17(21)14-6-2-5-13(11-14)12-18/h2,5-6,11,15-16H,3-4,7-10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | VDHOYJMAPOLDPW-HOTGVXAUSA-N |
| XLogP | 2.26 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |