C20H20N2O — CID 86951387
3-[2-(3,5-dimethylphenyl)pyrrolidine-1-carbonyl]benzonitrile (PubChem CID 86951387) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenyl)pyrrolidine-1-carbonyl]benzonitrile.
| Compound Name | 3-[2-(3,5-dimethylphenyl)pyrrolidine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 86951387 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[2-(3,5-dimethylphenyl)pyrrolidine-1-carbonyl]benzonitrile |
| SMILES | Cc1cc(C)cc(C2CCCN2C(=O)c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C20H20N2O/c1-14-9-15(2)11-18(10-14)19-7-4-8-22(19)20(23)17-6-3-5-16(12-17)13-21/h3,5-6,9-12,19H,4,7-8H2,1-2H3 |
| InChIKey | UQYFQPAGZDLAPS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |