C19H20N2O3 — CID 86951452
[2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 86951452) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is [2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 86951452 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | Cc1cc(C)cc(C2CCCN2C(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-13-9-14(2)11-16(10-13)18-7-4-8-20(18)19(22)15-5-3-6-17(12-15)21(23)24/h3,5-6,9-12,18H,4,7-8H2,1-2H3 |
| InChIKey | GIPYOSPWCPLEBQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|