C20H19N3O7 — CID 10621651
[1-(3-nitrobenzoyl)piperidin-2-yl]methyl 3-nitrobenzoate (PubChem CID 10621651) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is [1-(3-nitrobenzoyl)piperidin-2-yl]methyl 3-nitrobenzoate.
| Compound Name | [1-(3-nitrobenzoyl)piperidin-2-yl]methyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 10621651 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [1-(3-nitrobenzoyl)piperidin-2-yl]methyl 3-nitrobenzoate |
| SMILES | O=C(OCC1CCCCN1C(=O)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N3O7/c24-19(14-5-3-8-16(11-14)22(26)27)21-10-2-1-7-18(21)13-30-20(25)15-6-4-9-17(12-15)23(28)29/h3-6,8-9,11-12,18H,1-2,7,10,13H2 |
| InChIKey | BMBANFFNUBEHJG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|