C21H22N2O5 — CID 51337947
ethyl 3-(2-benzylpyrrolidine-1-carbonyl)-5-nitrobenzoate (PubChem CID 51337947) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl 3-(2-benzylpyrrolidine-1-carbonyl)-5-nitrobenzoate.
| Compound Name | ethyl 3-(2-benzylpyrrolidine-1-carbonyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 51337947 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethyl 3-(2-benzylpyrrolidine-1-carbonyl)-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)N2CCCC2Cc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22N2O5/c1-2-28-21(25)17-12-16(13-19(14-17)23(26)27)20(24)22-10-6-9-18(22)11-15-7-4-3-5-8-15/h3-5,7-8,12-14,18H,2,6,9-11H2,1H3 |
| InChIKey | IEEPJVRJGIUDFQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|