C21H23N3O5 — CID 46696411
ethyl 3-(2-cyclohexyliminopyridine-1-carbonyl)-5-nitrobenzoate (PubChem CID 46696411) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl 3-(2-cyclohexyliminopyridine-1-carbonyl)-5-nitrobenzoate.
| Compound Name | ethyl 3-(2-cyclohexyliminopyridine-1-carbonyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 46696411 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | ethyl 3-(2-cyclohexyliminopyridine-1-carbonyl)-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)n2cccc/c2=N\C2CCCCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O5/c1-2-29-21(26)16-12-15(13-18(14-16)24(27)28)20(25)23-11-7-6-10-19(23)22-17-8-4-3-5-9-17/h6-7,10-14,17H,2-5,8-9H2,1H3/b22-19+ |
| InChIKey | HLDBDZRDQRTCDD-ZBJSNUHESA-N |
| XLogP | 3.49 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|