C20H20N2O5S — CID 24541475
ethyl 3-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)-5-nitrobenzoate (PubChem CID 24541475) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is ethyl 3-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)-5-nitrobenzoate.
| Compound Name | ethyl 3-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 24541475 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | ethyl 3-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)N2CCC(C)Sc3ccccc32)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N2O5S/c1-3-27-20(24)15-10-14(11-16(12-15)22(25)26)19(23)21-9-8-13(2)28-18-7-5-4-6-17(18)21/h4-7,10-13H,3,8-9H2,1-2H3 |
| InChIKey | MUWLSNUTKSQPNS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|