C23H23N3O8 — CID 43010601
ethyl 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazine-1-carbonyl]-5-nitrobenzoate (PubChem CID 43010601) has the molecular formula C23H23N3O8 and a molecular weight of 469.45 g/mol. Its IUPAC name is ethyl 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazine-1-carbonyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazine-1-carbonyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 43010601 |
| Molecular Formula | C23H23N3O8 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | ethyl 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazine-1-carbonyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)N2CCN(C(=O)C3COc4ccccc4O3)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23N3O8/c1-2-32-23(29)16-11-15(12-17(13-16)26(30)31)21(27)24-7-9-25(10-8-24)22(28)20-14-33-18-5-3-4-6-19(18)34-20/h3-6,11-13,20H,2,7-10,14H2,1H3 |
| InChIKey | LRTWQZSAOYWIHZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|