C19H19N3O7S — CID 43012045
2,3-dihydro-1,4-benzodioxin-3-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 43012045) has the molecular formula C19H19N3O7S and a molecular weight of 433.44 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43012045 |
| Molecular Formula | C19H19N3O7S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1COc2ccccc2O1)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H19N3O7S/c23-19(18-13-28-16-3-1-2-4-17(16)29-18)20-9-11-21(12-10-20)30(26,27)15-7-5-14(6-8-15)22(24)25/h1-8,18H,9-13H2 |
| InChIKey | LVIJGKPJBBKTMM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|