C19H20N6O5 — CID 100574103
4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide (PubChem CID 100574103) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is 4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide.
| Compound Name | 4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 100574103 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ccc([N+](=O)[O-])cn1)N1CCN(C(=O)[C@@H]2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C19H20N6O5/c20-19(22-17-6-5-13(11-21-17)25(27)28)24-9-7-23(8-10-24)18(26)16-12-29-14-3-1-2-4-15(14)30-16/h1-6,11,16H,7-10,12H2,(H2,20,21,22)/t16-/m0/s1 |
| InChIKey | CSMAZLGRQNHWAK-INIZCTEOSA-N |
| XLogP | 0.92 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|