C12H18N6O3 — CID 100573962
4-(2-hydroxyethyl)-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide (PubChem CID 100573962) has the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2-hydroxyethyl)-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 100573962 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-(2-hydroxyethyl)-N'-(5-nitro-2-pyridinyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ccc([N+](=O)[O-])cn1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C12H18N6O3/c13-12(17-5-3-16(4-6-17)7-8-19)15-11-2-1-10(9-14-11)18(20)21/h1-2,9,19H,3-8H2,(H2,13,14,15) |
| InChIKey | RBSPMHRVMFANAW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|