About 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol
1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol (PubChem CID 158202191) has the molecular formula C18H29N3O4
and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol.
Molecular Properties
| Compound Name | 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol |
| PubChem CID | 158202191 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol |
| SMILES | O=[N+]([O-])c1ccc(OCCN2CCCC2)cc1.OCCN1CCCC1 |
| InChI | InChI=1S/C12H16N2O3.C6H13NO/c15-14(16)11-3-5-12(6-4-11)17-10-9-13-7-1-2-8-13;8-6-5-7-3-1-2-4-7/h3-6H,1-2,7-10H2;8H,1-6H2 |
| InChIKey | GBBNXRVNHKYSPH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol?
The IUPAC name of 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol (CID 158202191) is 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol.
What is the SMILES notation for 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol?
The canonical SMILES for 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol is O=[N+]([O-])c1ccc(OCCN2CCCC2)cc1.OCCN1CCCC1.
What is the InChIKey of 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol?
The InChIKey is GBBNXRVNHKYSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.C6H13NO/c15-14(16)11-3-5-12(6-4-11)17-10-9-13-7-1-2-8-13;8-6-5-7-3-1-2-4-7/h3-6H,1-2,7-10H2;8H,1-6H2.
What are the key properties of 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol?
1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol has a molecular weight of 351.45 g/mol, XLogP of 2.14, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine;2-pyrrolidin-1-ylethanol is sourced from PubChem (CID 158202191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).