C33H32N4O7 — CID 87674533
(3Z,5E)-3,5-bis[(4-nitrophenyl)methylidene]-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one (PubChem CID 87674533) has the molecular formula C33H32N4O7 and a molecular weight of 596.64 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(4-nitrophenyl)methylidene]-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(4-nitrophenyl)methylidene]-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one |
|---|---|
| PubChem CID | 87674533 |
| Molecular Formula | C33H32N4O7 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (3Z,5E)-3,5-bis[(4-nitrophenyl)methylidene]-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one |
| SMILES | O=C1/C(=C\c2ccc([N+](=O)[O-])cc2)CN(C(=O)c2ccc(OCCN3CCCCC3)cc2)C/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H32N4O7/c38-32-27(20-24-4-10-29(11-5-24)36(40)41)22-35(23-28(32)21-25-6-12-30(13-7-25)37(42)43)33(39)26-8-14-31(15-9-26)44-19-18-34-16-2-1-3-17-34/h4-15,20-21H,1-3,16-19,22-23H2/b27-20-,28-21+ |
| InChIKey | YUXGXJZFQKUJGO-LKZLBIQXSA-N |
| XLogP | 5.56 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|