C32H32Cl2N2O3 — CID 69052760
(3Z,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one (PubChem CID 69052760) has the molecular formula C32H32Cl2N2O3 and a molecular weight of 563.53 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one |
|---|---|
| PubChem CID | 69052760 |
| Molecular Formula | C32H32Cl2N2O3 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (3Z,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one |
| SMILES | CCN(CC)CCOc1ccc(C(=O)N2C/C(=C/c3ccc(Cl)cc3)C(=O)/C(=C/c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C32H32Cl2N2O3/c1-3-35(4-2)17-18-39-30-15-9-25(10-16-30)32(38)36-21-26(19-23-5-11-28(33)12-6-23)31(37)27(22-36)20-24-7-13-29(34)14-8-24/h5-16,19-20H,3-4,17-18,21-22H2,1-2H3/b26-19-,27-20+ |
| InChIKey | HCLDAOSLFOQWGD-XWFQURHXSA-N |
| XLogP | 6.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|