C32H34N2O3 — CID 69051448
(3Z,5E)-3,5-dibenzylidene-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one (PubChem CID 69051448) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is (3Z,5E)-3,5-dibenzylidene-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one.
| Compound Name | (3Z,5E)-3,5-dibenzylidene-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one |
|---|---|
| PubChem CID | 69051448 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (3Z,5E)-3,5-dibenzylidene-1-[4-[2-(diethylamino)ethoxy]benzoyl]piperidin-4-one |
| SMILES | CCN(CC)CCOc1ccc(C(=O)N2C/C(=C/c3ccccc3)C(=O)/C(=C/c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-3-33(4-2)19-20-37-30-17-15-27(16-18-30)32(36)34-23-28(21-25-11-7-5-8-12-25)31(35)29(24-34)22-26-13-9-6-10-14-26/h5-18,21-22H,3-4,19-20,23-24H2,1-2H3/b28-21-,29-22+ |
| InChIKey | XNUPNZBLCDYURW-FJYRUYPUSA-N |
| XLogP | 5.60 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|