C33H37ClN2O4 — CID 69053335
(3Z,5E)-3,5-dibenzylidene-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one;hydrate;hydrochloride (PubChem CID 69053335) has the molecular formula C33H37ClN2O4 and a molecular weight of 561.12 g/mol. Its IUPAC name is (3Z,5E)-3,5-dibenzylidene-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one;hydrate;hydrochloride.
| Compound Name | (3Z,5E)-3,5-dibenzylidene-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one;hydrate;hydrochloride |
|---|---|
| PubChem CID | 69053335 |
| Molecular Formula | C33H37ClN2O4 |
| Molecular Weight | 561.12 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (3Z,5E)-3,5-dibenzylidene-1-[4-(2-piperidin-1-ylethoxy)benzoyl]piperidin-4-one;hydrate;hydrochloride |
| SMILES | Cl.O.O=C1/C(=C\c2ccccc2)CN(C(=O)c2ccc(OCCN3CCCCC3)cc2)C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C33H34N2O3.ClH.H2O/c36-32-29(22-26-10-4-1-5-11-26)24-35(25-30(32)23-27-12-6-2-7-13-27)33(37)28-14-16-31(17-15-28)38-21-20-34-18-8-3-9-19-34;;/h1-2,4-7,10-17,22-23H,3,8-9,18-21,24-25H2;1H;1H2/b29-22-,30-23+;; |
| InChIKey | BSXWFLCVMOAKLX-NUFWIKJZSA-N |
| XLogP | 5.34 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|