C39H54N2O3 — CID 71519171
(2E,5E)-2,5-bis[[4-[4-(azepan-1-yl)butoxy]phenyl]methylidene]cyclopentan-1-one (PubChem CID 71519171) has the molecular formula C39H54N2O3 and a molecular weight of 598.87 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[[4-[4-(azepan-1-yl)butoxy]phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[[4-[4-(azepan-1-yl)butoxy]phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 71519171 |
| Molecular Formula | C39H54N2O3 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | (2E,5E)-2,5-bis[[4-[4-(azepan-1-yl)butoxy]phenyl]methylidene]cyclopentan-1-one |
| SMILES | O=C1/C(=C/c2ccc(OCCCCN3CCCCCC3)cc2)CC/C1=C\c1ccc(OCCCCN2CCCCCC2)cc1 |
| InChI | InChI=1S/C39H54N2O3/c42-39-35(31-33-13-19-37(20-14-33)43-29-11-9-27-40-23-5-1-2-6-24-40)17-18-36(39)32-34-15-21-38(22-16-34)44-30-12-10-28-41-25-7-3-4-8-26-41/h13-16,19-22,31-32H,1-12,17-18,23-30H2/b35-31+,36-32+ |
| InChIKey | RBCZZIOIRVETOL-QUTRQNJUSA-N |
| XLogP | 8.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|