C26H32ClNO4 — CID 118734143
(3E)-7-ethoxy-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methylidene]chromen-4-one;hydrochloride (PubChem CID 118734143) has the molecular formula C26H32ClNO4 and a molecular weight of 458.00 g/mol. Its IUPAC name is (3E)-7-ethoxy-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methylidene]chromen-4-one;hydrochloride.
| Compound Name | (3E)-7-ethoxy-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methylidene]chromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 118734143 |
| Molecular Formula | C26H32ClNO4 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (3E)-7-ethoxy-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methylidene]chromen-4-one;hydrochloride |
| SMILES | CCOc1ccc2c(c1)OC/C(=C\c1ccc(OCCCN3CCCCC3)cc1)C2=O.Cl |
| InChI | InChI=1S/C26H31NO4.ClH/c1-2-29-23-11-12-24-25(18-23)31-19-21(26(24)28)17-20-7-9-22(10-8-20)30-16-6-15-27-13-4-3-5-14-27;/h7-12,17-18H,2-6,13-16,19H2,1H3;1H/b21-17+; |
| InChIKey | MIFRTSUAZVHAJD-DIRYEVLESA-N |
| XLogP | 5.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|