C22H23NO3 — CID 74603716
3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]chromen-4-one (PubChem CID 74603716) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]chromen-4-one.
| Compound Name | 3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]chromen-4-one |
|---|---|
| PubChem CID | 74603716 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]chromen-4-one |
| SMILES | O=C1C(=Cc2ccc(OCCN3CCCC3)cc2)COc2ccccc21 |
| InChI | InChI=1S/C22H23NO3/c24-22-18(16-26-21-6-2-1-5-20(21)22)15-17-7-9-19(10-8-17)25-14-13-23-11-3-4-12-23/h1-2,5-10,15H,3-4,11-14,16H2 |
| InChIKey | XCDYHRHTVFMUBH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|