C31H38N2O5 — CID 71518525
(2E,5E)-2,5-bis[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]cyclopentan-1-one (PubChem CID 71518525) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 71518525 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | (2E,5E)-2,5-bis[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]cyclopentan-1-one |
| SMILES | O=C1/C(=C/c2ccc(OCCN3CCOCC3)cc2)CC/C1=C\c1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H38N2O5/c34-31-27(23-25-1-7-29(8-2-25)37-21-15-32-11-17-35-18-12-32)5-6-28(31)24-26-3-9-30(10-4-26)38-22-16-33-13-19-36-20-14-33/h1-4,7-10,23-24H,5-6,11-22H2/b27-23+,28-24+ |
| InChIKey | LKMNXBDRDCUUJO-LMCGJEQXSA-N |
| XLogP | 3.94 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|