C22H23NO5 — CID 118734124
(3E)-7-hydroxy-3-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]chromen-4-one (PubChem CID 118734124) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (3E)-7-hydroxy-3-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]chromen-4-one.
| Compound Name | (3E)-7-hydroxy-3-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]chromen-4-one |
|---|---|
| PubChem CID | 118734124 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (3E)-7-hydroxy-3-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]chromen-4-one |
| SMILES | O=C1/C(=C/c2ccc(OCCN3CCOCC3)cc2)COc2cc(O)ccc21 |
| InChI | InChI=1S/C22H23NO5/c24-18-3-6-20-21(14-18)28-15-17(22(20)25)13-16-1-4-19(5-2-16)27-12-9-23-7-10-26-11-8-23/h1-6,13-14,24H,7-12,15H2/b17-13+ |
| InChIKey | VRGYVGIDVVJINA-GHRIWEEISA-N |
| XLogP | 2.76 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|