C16H12O6 — CID 12000523
(3E)-7-hydroxy-3-[(3,4,5-trihydroxyphenyl)methylidene]chromen-4-one (PubChem CID 12000523) has the molecular formula C16H12O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is (3E)-7-hydroxy-3-[(3,4,5-trihydroxyphenyl)methylidene]chromen-4-one.
| Compound Name | (3E)-7-hydroxy-3-[(3,4,5-trihydroxyphenyl)methylidene]chromen-4-one |
|---|---|
| PubChem CID | 12000523 |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (3E)-7-hydroxy-3-[(3,4,5-trihydroxyphenyl)methylidene]chromen-4-one |
| SMILES | O=C1/C(=C/c2cc(O)c(O)c(O)c2)COc2cc(O)ccc21 |
| InChI | InChI=1S/C16H12O6/c17-10-1-2-11-14(6-10)22-7-9(15(11)20)3-8-4-12(18)16(21)13(19)5-8/h1-6,17-19,21H,7H2/b9-3+ |
| InChIKey | QDVCKCQMGXFGDF-YCRREMRBSA-N |
| XLogP | 2.17 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|