C19H16O7 — CID 6479356
(2E,5E)-2,5-bis[(3,4,5-trihydroxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 6479356) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[(3,4,5-trihydroxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[(3,4,5-trihydroxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 6479356 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (2E,5E)-2,5-bis[(3,4,5-trihydroxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | O=C1/C(=C/c2cc(O)c(O)c(O)c2)CC/C1=C\c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C19H16O7/c20-13-5-9(6-14(21)18(13)25)3-11-1-2-12(17(11)24)4-10-7-15(22)19(26)16(23)8-10/h3-8,20-23,25-26H,1-2H2/b11-3+,12-4+ |
| InChIKey | SZULJMIOVPHOQV-HMMKTVFPSA-N |
| XLogP | 2.75 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|