C19H14Br2O3 — CID 141291740
2,5-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 141291740) has the molecular formula C19H14Br2O3 and a molecular weight of 450.13 g/mol. Its IUPAC name is 2,5-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | 2,5-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 141291740 |
| Molecular Formula | C19H14Br2O3 |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 447.93 |
| IUPAC Name | 2,5-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | O=C1C(=Cc2ccc(O)c(Br)c2)CCC1=Cc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C19H14Br2O3/c20-15-9-11(1-5-17(15)22)7-13-3-4-14(19(13)24)8-12-2-6-18(23)16(21)10-12/h1-2,5-10,22-23H,3-4H2 |
| InChIKey | RLIAEUPCYYOVLS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|