C23H24O5 — CID 177487942
(2Z,7Z)-2,7-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cycloheptan-1-one (PubChem CID 177487942) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2Z,7Z)-2,7-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cycloheptan-1-one.
| Compound Name | (2Z,7Z)-2,7-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cycloheptan-1-one |
|---|---|
| PubChem CID | 177487942 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2Z,7Z)-2,7-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cycloheptan-1-one |
| SMILES | COc1cc(/C=C2/CCCC/C(=C/c3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C23H24O5/c1-27-21-13-15(7-9-19(21)24)11-17-5-3-4-6-18(23(17)26)12-16-8-10-20(25)22(14-16)28-2/h7-14,24-25H,3-6H2,1-2H3/b17-11-,18-12- |
| InChIKey | QWSQWPYKRISGNM-WHYMJUELSA-N |
| XLogP | 4.73 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|