C21H21NO5 — CID 72983742
3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one (PubChem CID 72983742) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | 3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 72983742 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1cc(C=C2CNCC(=Cc3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C21H21NO5/c1-26-19-9-13(3-5-17(19)23)7-15-11-22-12-16(21(15)25)8-14-4-6-18(24)20(10-14)27-2/h3-10,22-24H,11-12H2,1-2H3 |
| InChIKey | QKBRHSFMRAGHMJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|