C23H23NO6 — CID 86580608
(3Z,5E)-1-acetyl-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one (PubChem CID 86580608) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (3Z,5E)-1-acetyl-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3Z,5E)-1-acetyl-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 86580608 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (3Z,5E)-1-acetyl-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1cc(/C=C2/CN(C(C)=O)C/C(=C\c3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C23H23NO6/c1-14(25)24-12-17(8-15-4-6-19(26)21(10-15)29-2)23(28)18(13-24)9-16-5-7-20(27)22(11-16)30-3/h4-11,26-27H,12-13H2,1-3H3/b17-8-,18-9+ |
| InChIKey | CCJHZHDCCXFHGL-IADIARBNSA-N |
| XLogP | 3.01 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|