C21H18Cl2O3 — CID 127025747
(2E,6E)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 127025747) has the molecular formula C21H18Cl2O3 and a molecular weight of 389.28 g/mol. Its IUPAC name is (2E,6E)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 127025747 |
| Molecular Formula | C21H18Cl2O3 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (2E,6E)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC/C(=C\c3ccc(Cl)c(Cl)c3)C2=O)ccc1O |
| InChI | InChI=1S/C21H18Cl2O3/c1-26-20-12-14(6-8-19(20)24)10-16-4-2-3-15(21(16)25)9-13-5-7-17(22)18(23)11-13/h5-12,24H,2-4H2,1H3/b15-9+,16-10+ |
| InChIKey | DCVZGKGUZWYYBC-KAVGSWPWSA-N |
| XLogP | 5.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|