C22H22O5 — CID 11366
2,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 11366) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | 2,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 11366 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(C=C2CCCC(=Cc3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C22H22O5/c1-26-20-12-14(6-8-18(20)23)10-16-4-3-5-17(22(16)25)11-15-7-9-19(24)21(13-15)27-2/h6-13,23-24H,3-5H2,1-2H3 |
| InChIKey | DHKKONBXGAAFTB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|