C23H24O5 — CID 127025458
(2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 127025458) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 127025458 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC/C(=C\c3cccc(OC)c3OC)C2=O)ccc1O |
| InChI | InChI=1S/C23H24O5/c1-26-20-9-5-8-18(23(20)28-3)14-17-7-4-6-16(22(17)25)12-15-10-11-19(24)21(13-15)27-2/h5,8-14,24H,4,6-7H2,1-3H3/b16-12+,17-14+ |
| InChIKey | XRSDOUSWFNOFRR-DEGBXGGYSA-N |
| XLogP | 4.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|